C21H29N7O3 — CID 129108990
[(1R,3R)-3-[[3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentyl]-(2-methoxyethylamino)methanol (PubChem CID 129108990) has the molecular formula C21H29N7O3 and a molecular weight of 427.51 g/mol. Its IUPAC name is [(1R,3R)-3-[[3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentyl]-(2-methoxyethylamino)methanol.
| Compound Name | [(1R,3R)-3-[[3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentyl]-(2-methoxyethylamino)methanol |
|---|---|
| PubChem CID | 129108990 |
| Molecular Formula | C21H29N7O3 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [(1R,3R)-3-[[3-(4-ethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentyl]-(2-methoxyethylamino)methanol |
| SMILES | CCOc1ccc(-n2nnc3cnc(N[C@@H]4CC[C@@H](C(O)NCCOC)C4)nc32)cc1 |
| InChI | InChI=1S/C21H29N7O3/c1-3-31-17-8-6-16(7-9-17)28-19-18(26-27-28)13-23-21(25-19)24-15-5-4-14(12-15)20(29)22-10-11-30-2/h6-9,13-15,20,22,29H,3-5,10-12H2,1-2H3,(H,23,24,25)/t14-,15-,20?/m1/s1 |
| InChIKey | DVWTVMJTJUYBFU-YNCRUDOASA-N |
| XLogP | 1.74 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|