C19H24N6O2 — CID 129094398
N-cyclopentyl-3-[4-(2-ethoxyethoxy)phenyl]triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 129094398) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-cyclopentyl-3-[4-(2-ethoxyethoxy)phenyl]triazolo[4,5-d]pyrimidin-5-amine.
| Compound Name | N-cyclopentyl-3-[4-(2-ethoxyethoxy)phenyl]triazolo[4,5-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 129094398 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-cyclopentyl-3-[4-(2-ethoxyethoxy)phenyl]triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | CCOCCOc1ccc(-n2nnc3cnc(NC4CCCC4)nc32)cc1 |
| InChI | InChI=1S/C19H24N6O2/c1-2-26-11-12-27-16-9-7-15(8-10-16)25-18-17(23-24-25)13-20-19(22-18)21-14-5-3-4-6-14/h7-10,13-14H,2-6,11-12H2,1H3,(H,20,21,22) |
| InChIKey | ZFMCODXSBOBQRR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|