C33H44N4 — CID 129113566
4-(3,3-dimethylpiperidin-1-yl)-6-(2-methyl-5-propan-2-ylphenyl)-2-(2,4,6-trimethylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 129113566) has the molecular formula C33H44N4 and a molecular weight of 496.74 g/mol. Its IUPAC name is 4-(3,3-dimethylpiperidin-1-yl)-6-(2-methyl-5-propan-2-ylphenyl)-2-(2,4,6-trimethylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3,3-dimethylpiperidin-1-yl)-6-(2-methyl-5-propan-2-ylphenyl)-2-(2,4,6-trimethylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 129113566 |
| Molecular Formula | C33H44N4 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | 4-(3,3-dimethylpiperidin-1-yl)-6-(2-methyl-5-propan-2-ylphenyl)-2-(2,4,6-trimethylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Cc1cc(C)c(-c2nc3c(c(N4CCCC(C)(C)C4)n2)CN(c2cc(C(C)C)ccc2C)CC3)c(C)c1 |
| InChI | InChI=1S/C33H44N4/c1-21(2)26-11-10-23(4)29(18-26)36-15-12-28-27(19-36)32(37-14-9-13-33(7,8)20-37)35-31(34-28)30-24(5)16-22(3)17-25(30)6/h10-11,16-18,21H,9,12-15,19-20H2,1-8H3 |
| InChIKey | FQMZLXFUCMELNI-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |