C33H43N5O — CID 71244797
1-[(2S,5R)-4-[2-(2,6-dimethylphenyl)-6-(2-methyl-5-propan-2-ylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 71244797) has the molecular formula C33H43N5O and a molecular weight of 525.74 g/mol. Its IUPAC name is 1-[(2S,5R)-4-[2-(2,6-dimethylphenyl)-6-(2-methyl-5-propan-2-ylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 1-[(2S,5R)-4-[2-(2,6-dimethylphenyl)-6-(2-methyl-5-propan-2-ylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 71244797 |
| Molecular Formula | C33H43N5O |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.35 |
| IUPAC Name | 1-[(2S,5R)-4-[2-(2,6-dimethylphenyl)-6-(2-methyl-5-propan-2-ylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H](C)N(c2nc(-c3c(C)cccc3C)nc3c2CN(c2cc(C(C)C)ccc2C)CC3)C[C@@H]1C |
| InChI | InChI=1S/C33H43N5O/c1-20(2)27-13-12-21(3)30(16-27)36-15-14-29-28(19-36)33(38-18-24(6)37(26(8)39)17-25(38)7)35-32(34-29)31-22(4)10-9-11-23(31)5/h9-13,16,20,24-25H,14-15,17-19H2,1-8H3/t24-,25+/m0/s1 |
| InChIKey | UHJCVVGGMVJSRT-LOSJGSFVSA-N |
| XLogP | 6.20 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |