C21H41NO4 — CID 129115111
2-[[(Z)-1,1-dihydroxynonadec-10-enyl]amino]acetic acid (PubChem CID 129115111) has the molecular formula C21H41NO4 and a molecular weight of 371.56 g/mol. Its IUPAC name is 2-[[(Z)-1,1-dihydroxynonadec-10-enyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-1,1-dihydroxynonadec-10-enyl]amino]acetic acid |
|---|---|
| PubChem CID | 129115111 |
| Molecular Formula | C21H41NO4 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | 2-[[(Z)-1,1-dihydroxynonadec-10-enyl]amino]acetic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(O)(O)NCC(=O)O |
| InChI | InChI=1S/C21H41NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(25,26)22-19-20(23)24/h9-10,22,25-26H,2-8,11-19H2,1H3,(H,23,24)/b10-9- |
| InChIKey | ADWOSOHUNOLQAG-KTKRTIGZSA-N |
| XLogP | 4.73 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|