C17H14ClFN2O3 — CID 129115468
[1-(4-chlorophenyl)cyclopropyl]carbamoyl-(3-fluorophenyl)carbamic acid (PubChem CID 129115468) has the molecular formula C17H14ClFN2O3 and a molecular weight of 348.76 g/mol. Its IUPAC name is [1-(4-chlorophenyl)cyclopropyl]carbamoyl-(3-fluorophenyl)carbamic acid.
| Compound Name | [1-(4-chlorophenyl)cyclopropyl]carbamoyl-(3-fluorophenyl)carbamic acid |
|---|---|
| PubChem CID | 129115468 |
| Molecular Formula | C17H14ClFN2O3 |
| Molecular Weight | 348.76 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | [1-(4-chlorophenyl)cyclopropyl]carbamoyl-(3-fluorophenyl)carbamic acid |
| SMILES | O=C(O)N(C(=O)NC1(c2ccc(Cl)cc2)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H14ClFN2O3/c18-12-6-4-11(5-7-12)17(8-9-17)20-15(22)21(16(23)24)14-3-1-2-13(19)10-14/h1-7,10H,8-9H2,(H,20,22)(H,23,24) |
| InChIKey | YTQJSPIGMZOVRY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.76 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |