C20H19Cl2N5O2 — CID 129115797
4-[5-[3-chloro-4-(dimethylcarbamoyl)phenyl]-3-cyano-2-pyridinyl]piperazine-1-carbonyl chloride (PubChem CID 129115797) has the molecular formula C20H19Cl2N5O2 and a molecular weight of 432.31 g/mol. Its IUPAC name is 4-[5-[3-chloro-4-(dimethylcarbamoyl)phenyl]-3-cyano-2-pyridinyl]piperazine-1-carbonyl chloride.
| Compound Name | 4-[5-[3-chloro-4-(dimethylcarbamoyl)phenyl]-3-cyano-2-pyridinyl]piperazine-1-carbonyl chloride |
|---|---|
| PubChem CID | 129115797 |
| Molecular Formula | C20H19Cl2N5O2 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 4-[5-[3-chloro-4-(dimethylcarbamoyl)phenyl]-3-cyano-2-pyridinyl]piperazine-1-carbonyl chloride |
| SMILES | CN(C)C(=O)c1ccc(-c2cnc(N3CCN(C(=O)Cl)CC3)c(C#N)c2)cc1Cl |
| InChI | InChI=1S/C20H19Cl2N5O2/c1-25(2)19(28)16-4-3-13(10-17(16)21)15-9-14(11-23)18(24-12-15)26-5-7-27(8-6-26)20(22)29/h3-4,9-10,12H,5-8H2,1-2H3 |
| InChIKey | LWXYFITWVTWJSW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|