C22H26ClN5OS — CID 145309714
2-chloro-4-[5-cyano-6-(4-propan-2-ylsulfanylpiperazin-1-yl)-3-pyridinyl]-N,N-dimethylbenzamide (PubChem CID 145309714) has the molecular formula C22H26ClN5OS and a molecular weight of 444.00 g/mol. Its IUPAC name is 2-chloro-4-[5-cyano-6-(4-propan-2-ylsulfanylpiperazin-1-yl)-3-pyridinyl]-N,N-dimethylbenzamide.
| Compound Name | 2-chloro-4-[5-cyano-6-(4-propan-2-ylsulfanylpiperazin-1-yl)-3-pyridinyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 145309714 |
| Molecular Formula | C22H26ClN5OS |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-chloro-4-[5-cyano-6-(4-propan-2-ylsulfanylpiperazin-1-yl)-3-pyridinyl]-N,N-dimethylbenzamide |
| SMILES | CC(C)SN1CCN(c2ncc(-c3ccc(C(=O)N(C)C)c(Cl)c3)cc2C#N)CC1 |
| InChI | InChI=1S/C22H26ClN5OS/c1-15(2)30-28-9-7-27(8-10-28)21-17(13-24)11-18(14-25-21)16-5-6-19(20(23)12-16)22(29)26(3)4/h5-6,11-12,14-15H,7-10H2,1-4H3 |
| InChIKey | FQICTIHPAHBCCI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|