C11H15NO3 — CID 129116376
ethyl 2-(5-hydroxy-4,6-dimethyl-3-pyridinyl)acetate (PubChem CID 129116376) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is ethyl 2-(5-hydroxy-4,6-dimethyl-3-pyridinyl)acetate.
| Compound Name | ethyl 2-(5-hydroxy-4,6-dimethyl-3-pyridinyl)acetate |
|---|---|
| PubChem CID | 129116376 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | ethyl 2-(5-hydroxy-4,6-dimethyl-3-pyridinyl)acetate |
| SMILES | CCOC(=O)Cc1cnc(C)c(O)c1C |
| InChI | InChI=1S/C11H15NO3/c1-4-15-10(13)5-9-6-12-8(3)11(14)7(9)2/h6,14H,4-5H2,1-3H3 |
| InChIKey | NWBJQTUWFDURJH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |