C11H11F3INO3 — CID 134659980
ethyl 2-[4-iodo-6-methyl-5-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134659980) has the molecular formula C11H11F3INO3 and a molecular weight of 389.11 g/mol. Its IUPAC name is ethyl 2-[4-iodo-6-methyl-5-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[4-iodo-6-methyl-5-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134659980 |
| Molecular Formula | C11H11F3INO3 |
| Molecular Weight | 389.11 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | ethyl 2-[4-iodo-6-methyl-5-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cnc(C)c(OC(F)(F)F)c1I |
| InChI | InChI=1S/C11H11F3INO3/c1-3-18-8(17)4-7-5-16-6(2)10(9(7)15)19-11(12,13)14/h5H,3-4H2,1-2H3 |
| InChIKey | PBFFPWUSQLRRSA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.11 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|