C36H48N2O3 — CID 129117620
decyl 2-[3,6-bis(ethylamino)-2,7-dimethyl-4aH-xanthen-9-yl]benzoate (PubChem CID 129117620) has the molecular formula C36H48N2O3 and a molecular weight of 556.79 g/mol. Its IUPAC name is decyl 2-[3,6-bis(ethylamino)-2,7-dimethyl-4aH-xanthen-9-yl]benzoate.
| Compound Name | decyl 2-[3,6-bis(ethylamino)-2,7-dimethyl-4aH-xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 129117620 |
| Molecular Formula | C36H48N2O3 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | decyl 2-[3,6-bis(ethylamino)-2,7-dimethyl-4aH-xanthen-9-yl]benzoate |
| SMILES | CCCCCCCCCCOC(=O)c1ccccc1C1=C2C=C(C)C(NCC)=CC2Oc2cc(NCC)c(C)cc21 |
| InChI | InChI=1S/C36H48N2O3/c1-6-9-10-11-12-13-14-17-20-40-36(39)28-19-16-15-18-27(28)35-29-21-25(4)31(37-7-2)23-33(29)41-34-24-32(38-8-3)26(5)22-30(34)35/h15-16,18-19,21-24,33,37-38H,6-14,17,20H2,1-5H3 |
| InChIKey | IUGKMKIJPNFSOY-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|