C22H22F6O4 — CID 129118544
[5-[2-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl]oxypropan-2-yl]naphthalen-2-yl] 2-methylprop-2-enoate (PubChem CID 129118544) has the molecular formula C22H22F6O4 and a molecular weight of 464.40 g/mol. Its IUPAC name is [5-[2-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl]oxypropan-2-yl]naphthalen-2-yl] 2-methylprop-2-enoate.
| Compound Name | [5-[2-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl]oxypropan-2-yl]naphthalen-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118544 |
| Molecular Formula | C22H22F6O4 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [5-[2-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butan-2-yl]oxypropan-2-yl]naphthalen-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(C(C)(C)OC(C)C(O)(C(F)(F)F)C(F)(F)F)cccc2c1 |
| InChI | InChI=1S/C22H22F6O4/c1-12(2)18(29)31-15-9-10-16-14(11-15)7-6-8-17(16)19(4,5)32-13(3)20(30,21(23,24)25)22(26,27)28/h6-11,13,30H,1H2,2-5H3 |
| InChIKey | CFTKAOWDEYAVCJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|