C21H20F6O4 — CID 129118716
[5-[2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]propan-2-yl]naphthalen-2-yl] 2-methylprop-2-enoate (PubChem CID 129118716) has the molecular formula C21H20F6O4 and a molecular weight of 450.38 g/mol. Its IUPAC name is [5-[2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]propan-2-yl]naphthalen-2-yl] 2-methylprop-2-enoate.
| Compound Name | [5-[2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]propan-2-yl]naphthalen-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118716 |
| Molecular Formula | C21H20F6O4 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | [5-[2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]propan-2-yl]naphthalen-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(C(C)(C)OCC(O)(C(F)(F)F)C(F)(F)F)cccc2c1 |
| InChI | InChI=1S/C21H20F6O4/c1-12(2)17(28)31-14-8-9-15-13(10-14)6-5-7-16(15)18(3,4)30-11-19(29,20(22,23)24)21(25,26)27/h5-10,29H,1,11H2,2-4H3 |
| InChIKey | DIEYQEBSVRIHJA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|