C44H51FO2S — CID 129119963
2,12-bis(3-tert-butyl-3-methoxy-4,4-dimethylpent-1-ynyl)-7-fluoro-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene (PubChem CID 129119963) has the molecular formula C44H51FO2S and a molecular weight of 662.96 g/mol. Its IUPAC name is 2,12-bis(3-tert-butyl-3-methoxy-4,4-dimethylpent-1-ynyl)-7-fluoro-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene.
| Compound Name | 2,12-bis(3-tert-butyl-3-methoxy-4,4-dimethylpent-1-ynyl)-7-fluoro-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 129119963 |
| Molecular Formula | C44H51FO2S |
| Molecular Weight | 662.96 g/mol |
| Exact Mass | 662.36 |
| IUPAC Name | 2,12-bis(3-tert-butyl-3-methoxy-4,4-dimethylpent-1-ynyl)-7-fluoro-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
| SMILES | COC(C#Cc1c2cc3ccccc3cc2c(C#CC(OC)(C(C)(C)C)C(C)(C)C)c2cc3sc(F)cc3cc12)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C44H51FO2S/c1-39(2,3)43(46-13,40(4,5)6)21-19-31-33-23-28-17-15-16-18-29(28)24-34(33)32(20-22-44(47-14,41(7,8)9)42(10,11)12)36-27-37-30(25-35(31)36)26-38(45)48-37/h15-18,23-27H,1-14H3 |
| InChIKey | WFHJWSYTNAFTSX-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.96 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|