C26H43NO3 — CID 129120416
(11E)-11-[(11Z)-2-oxo-1-oxacyclotetradec-11-en-4-yl]-1-azacyclotetradec-11-en-2-one (PubChem CID 129120416) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is (11E)-11-[(11Z)-2-oxo-1-oxacyclotetradec-11-en-4-yl]-1-azacyclotetradec-11-en-2-one.
| Compound Name | (11E)-11-[(11Z)-2-oxo-1-oxacyclotetradec-11-en-4-yl]-1-azacyclotetradec-11-en-2-one |
|---|---|
| PubChem CID | 129120416 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | (11E)-11-[(11Z)-2-oxo-1-oxacyclotetradec-11-en-4-yl]-1-azacyclotetradec-11-en-2-one |
| SMILES | O=C1CCCCCCCC/C(C2CCCCCC/C=C\CCOC(=O)C2)=C\CCN1 |
| InChI | InChI=1S/C26H43NO3/c28-25-19-13-9-5-4-7-11-16-23(18-15-20-27-25)24-17-12-8-3-1-2-6-10-14-21-30-26(29)22-24/h6,10,18,24H,1-5,7-9,11-17,19-22H2,(H,27,28)/b10-6-,23-18+ |
| InChIKey | VSQBLPZNFPZHRR-QITMNJLISA-N |
| XLogP | 6.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|