C39H56O2 — CID 129126642
(3R,3aR,6S,8R,9R)-3-[(2R)-5,5-diphenylpent-4-en-2-yl]-8-ethyl-6-[(3S)-3-hydroxypentyl]-3a,6-dimethyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-9-ol (PubChem CID 129126642) has the molecular formula C39H56O2 and a molecular weight of 556.88 g/mol. Its IUPAC name is (3R,3aR,6S,8R,9R)-3-[(2R)-5,5-diphenylpent-4-en-2-yl]-8-ethyl-6-[(3S)-3-hydroxypentyl]-3a,6-dimethyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-9-ol.
| Compound Name | (3R,3aR,6S,8R,9R)-3-[(2R)-5,5-diphenylpent-4-en-2-yl]-8-ethyl-6-[(3S)-3-hydroxypentyl]-3a,6-dimethyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-9-ol |
|---|---|
| PubChem CID | 129126642 |
| Molecular Formula | C39H56O2 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | (3R,3aR,6S,8R,9R)-3-[(2R)-5,5-diphenylpent-4-en-2-yl]-8-ethyl-6-[(3S)-3-hydroxypentyl]-3a,6-dimethyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-9-ol |
| SMILES | CC[C@H](O)CC[C@@]1(C)C[C@@H](CC)C(O)C2C1CC[C@@]1(C)C2CC[C@@H]1[C@H](C)CC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H56O2/c1-6-28-26-38(4,24-22-31(40)7-2)34-23-25-39(5)33(20-21-35(39)36(34)37(28)41)27(3)18-19-32(29-14-10-8-11-15-29)30-16-12-9-13-17-30/h8-17,19,27-28,31,33-37,40-41H,6-7,18,20-26H2,1-5H3/t27-,28-,31+,33-,34?,35?,36?,37?,38+,39-/m1/s1 |
| InChIKey | WZOHTXDBXFLVOF-ZRWJNPMUSA-N |
| XLogP | 9.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |