C36H48O2 — CID 126739287
(3R,5S,10S,13R,17R)-17-[(2R)-5,5-diphenylpent-4-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 126739287) has the molecular formula C36H48O2 and a molecular weight of 512.78 g/mol. Its IUPAC name is (3R,5S,10S,13R,17R)-17-[(2R)-5,5-diphenylpent-4-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3R,5S,10S,13R,17R)-17-[(2R)-5,5-diphenylpent-4-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 126739287 |
| Molecular Formula | C36H48O2 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | (3R,5S,10S,13R,17R)-17-[(2R)-5,5-diphenylpent-4-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | C[C@H](CC=C(c1ccccc1)c1ccccc1)[C@H]1CCC2C3C(O)C[C@@H]4C[C@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C36H48O2/c1-24(14-15-29(25-10-6-4-7-11-25)26-12-8-5-9-13-26)30-16-17-31-34-32(19-21-36(30,31)3)35(2)20-18-28(37)22-27(35)23-33(34)38/h4-13,15,24,27-28,30-34,37-38H,14,16-23H2,1-3H3/t24-,27+,28-,30-,31?,32?,33?,34?,35+,36-/m1/s1 |
| InChIKey | SJKLKSOUHDQFMM-UDKVOIBPSA-N |
| XLogP | 8.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |