C24H23FN4O2 — CID 129127722
4-fluoro-2-[(6-oxo-5-phenylmethoxy-2-piperidin-1-ylpyrimidin-1-yl)methyl]benzonitrile (PubChem CID 129127722) has the molecular formula C24H23FN4O2 and a molecular weight of 418.47 g/mol. Its IUPAC name is 4-fluoro-2-[(6-oxo-5-phenylmethoxy-2-piperidin-1-ylpyrimidin-1-yl)methyl]benzonitrile.
| Compound Name | 4-fluoro-2-[(6-oxo-5-phenylmethoxy-2-piperidin-1-ylpyrimidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 129127722 |
| Molecular Formula | C24H23FN4O2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 4-fluoro-2-[(6-oxo-5-phenylmethoxy-2-piperidin-1-ylpyrimidin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)cc1Cn1c(N2CCCCC2)ncc(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C24H23FN4O2/c25-21-10-9-19(14-26)20(13-21)16-29-23(30)22(31-17-18-7-3-1-4-8-18)15-27-24(29)28-11-5-2-6-12-28/h1,3-4,7-10,13,15H,2,5-6,11-12,16-17H2 |
| InChIKey | ZMUSINMMAGOTFS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |