C24H25N5O2 — CID 68625702
2-[[2-(3-aminopiperidin-1-yl)-5-(2-methoxyphenyl)-6-oxopyrimidin-1-yl]methyl]benzonitrile (PubChem CID 68625702) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-[[2-(3-aminopiperidin-1-yl)-5-(2-methoxyphenyl)-6-oxopyrimidin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[2-(3-aminopiperidin-1-yl)-5-(2-methoxyphenyl)-6-oxopyrimidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 68625702 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-[[2-(3-aminopiperidin-1-yl)-5-(2-methoxyphenyl)-6-oxopyrimidin-1-yl]methyl]benzonitrile |
| SMILES | COc1ccccc1-c1cnc(N2CCCC(N)C2)n(Cc2ccccc2C#N)c1=O |
| InChI | InChI=1S/C24H25N5O2/c1-31-22-11-5-4-10-20(22)21-14-27-24(28-12-6-9-19(26)16-28)29(23(21)30)15-18-8-3-2-7-17(18)13-25/h2-5,7-8,10-11,14,19H,6,9,12,15-16,26H2,1H3 |
| InChIKey | QLZHWZWLQAFWAT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |