C17H19N5O — CID 11392716
2-[[2-[(3R)-3-aminopiperidin-1-yl]-6-oxopyrimidin-1-yl]methyl]benzonitrile (PubChem CID 11392716) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[[2-[(3R)-3-aminopiperidin-1-yl]-6-oxopyrimidin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[2-[(3R)-3-aminopiperidin-1-yl]-6-oxopyrimidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 11392716 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[[2-[(3R)-3-aminopiperidin-1-yl]-6-oxopyrimidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cn1c(N2CCC[C@@H](N)C2)nccc1=O |
| InChI | InChI=1S/C17H19N5O/c18-10-13-4-1-2-5-14(13)11-22-16(23)7-8-20-17(22)21-9-3-6-15(19)12-21/h1-2,4-5,7-8,15H,3,6,9,11-12,19H2/t15-/m1/s1 |
| InChIKey | POHSBHIAGHYTOC-OAHLLOKOSA-N |
| XLogP | 1.09 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |