C19H27N3O — CID 129128045
6-methyl-N-[4-(3-methylcyclopentyl)butan-2-yl]-1H-indazole-3-carboxamide (PubChem CID 129128045) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 6-methyl-N-[4-(3-methylcyclopentyl)butan-2-yl]-1H-indazole-3-carboxamide.
| Compound Name | 6-methyl-N-[4-(3-methylcyclopentyl)butan-2-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 129128045 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 6-methyl-N-[4-(3-methylcyclopentyl)butan-2-yl]-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc2c(C(=O)NC(C)CCC3CCC(C)C3)n[nH]c2c1 |
| InChI | InChI=1S/C19H27N3O/c1-12-4-7-15(10-12)8-6-14(3)20-19(23)18-16-9-5-13(2)11-17(16)21-22-18/h5,9,11-12,14-15H,4,6-8,10H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | FUOAJBPVWOCACQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |