C18H19N3O2 — CID 52777916
N-[(2R)-1-(4-methylphenoxy)propan-2-yl]-1H-indazole-3-carboxamide (PubChem CID 52777916) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[(2R)-1-(4-methylphenoxy)propan-2-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[(2R)-1-(4-methylphenoxy)propan-2-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 52777916 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[(2R)-1-(4-methylphenoxy)propan-2-yl]-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc(OC[C@@H](C)NC(=O)c2n[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C18H19N3O2/c1-12-7-9-14(10-8-12)23-11-13(2)19-18(22)17-15-5-3-4-6-16(15)20-21-17/h3-10,13H,11H2,1-2H3,(H,19,22)(H,20,21)/t13-/m1/s1 |
| InChIKey | VUBLTIIZYZGYEH-CYBMUJFWSA-N |
| XLogP | 3.07 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |