C18H18BrN3O — CID 52734946
N-[(2S)-4-(4-bromophenyl)butan-2-yl]-1H-indazole-3-carboxamide (PubChem CID 52734946) has the molecular formula C18H18BrN3O and a molecular weight of 372.27 g/mol. Its IUPAC name is N-[(2S)-4-(4-bromophenyl)butan-2-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[(2S)-4-(4-bromophenyl)butan-2-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 52734946 |
| Molecular Formula | C18H18BrN3O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-[(2S)-4-(4-bromophenyl)butan-2-yl]-1H-indazole-3-carboxamide |
| SMILES | C[C@@H](CCc1ccc(Br)cc1)NC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C18H18BrN3O/c1-12(6-7-13-8-10-14(19)11-9-13)20-18(23)17-15-4-2-3-5-16(15)21-22-17/h2-5,8-12H,6-7H2,1H3,(H,20,23)(H,21,22)/t12-/m0/s1 |
| InChIKey | SNVMRKOJSFXFLG-LBPRGKRZSA-N |
| XLogP | 4.08 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |