C17H16ClN7O3S — CID 129130497
2-[6-(3-chloro-1,2,4-triazol-1-yl)-3-ethylsulfonyl-2-pyridinyl]-3,6-dimethyl-4-oxidoimidazo[4,5-b]pyridin-4-ium (PubChem CID 129130497) has the molecular formula C17H16ClN7O3S and a molecular weight of 433.88 g/mol. Its IUPAC name is 2-[6-(3-chloro-1,2,4-triazol-1-yl)-3-ethylsulfonyl-2-pyridinyl]-3,6-dimethyl-4-oxidoimidazo[4,5-b]pyridin-4-ium.
| Compound Name | 2-[6-(3-chloro-1,2,4-triazol-1-yl)-3-ethylsulfonyl-2-pyridinyl]-3,6-dimethyl-4-oxidoimidazo[4,5-b]pyridin-4-ium |
|---|---|
| PubChem CID | 129130497 |
| Molecular Formula | C17H16ClN7O3S |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-[6-(3-chloro-1,2,4-triazol-1-yl)-3-ethylsulfonyl-2-pyridinyl]-3,6-dimethyl-4-oxidoimidazo[4,5-b]pyridin-4-ium |
| SMILES | CCS(=O)(=O)c1ccc(-n2cnc(Cl)n2)nc1-c1nc2cc(C)c[n+]([O-])c2n1C |
| InChI | InChI=1S/C17H16ClN7O3S/c1-4-29(27,28)12-5-6-13(24-9-19-17(18)22-24)21-14(12)15-20-11-7-10(2)8-25(26)16(11)23(15)3/h5-9H,4H2,1-3H3 |
| InChIKey | VKVHNQVMQLKIJU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 122.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|