C15H17N5O — CID 129131122
(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbaldehyde (PubChem CID 129131122) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is (3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbaldehyde.
| Compound Name | (3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 129131122 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidine-1-carbaldehyde |
| SMILES | C[C@@H]1CCN(C=O)C[C@@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C15H17N5O/c1-10-3-5-19(9-21)8-12(10)15-18-7-11-6-17-14-13(20(11)15)2-4-16-14/h2,4,6-7,9-10,12,16H,3,5,8H2,1H3/t10-,12+/m1/s1 |
| InChIKey | NNGUHHXVDKMOKZ-PWSUYJOCSA-N |
| XLogP | 1.79 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|