C20H26N6O — CID 67998637
(3-methylpyrrolidin-1-yl)-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone (PubChem CID 67998637) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is (3-methylpyrrolidin-1-yl)-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone.
| Compound Name | (3-methylpyrrolidin-1-yl)-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 67998637 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (3-methylpyrrolidin-1-yl)-[(3R,4R)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]methanone |
| SMILES | CC1CCN(C(=O)N2CC[C@@H](C)[C@@H](c3ncc4cnc5[nH]ccc5n34)C2)C1 |
| InChI | InChI=1S/C20H26N6O/c1-13-4-7-24(11-13)20(27)25-8-5-14(2)16(12-25)19-23-10-15-9-22-18-17(26(15)19)3-6-21-18/h3,6,9-10,13-14,16,21H,4-5,7-8,11-12H2,1-2H3/t13?,14-,16+/m1/s1 |
| InChIKey | ZWEKLPZLKYYXGU-VVRWDSKXSA-N |
| XLogP | 3.10 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |