C18H20N6O — CID 58557997
4-[(3S,4S)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-4-oxobutanenitrile (PubChem CID 58557997) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-[(3S,4S)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-4-oxobutanenitrile.
| Compound Name | 4-[(3S,4S)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-4-oxobutanenitrile |
|---|---|
| PubChem CID | 58557997 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-[(3S,4S)-4-methyl-3-(1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)piperidin-1-yl]-4-oxobutanenitrile |
| SMILES | C[C@H]1CCN(C(=O)CCC#N)C[C@H]1c1ncc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C18H20N6O/c1-12-5-8-23(16(25)3-2-6-19)11-14(12)18-22-10-13-9-21-17-15(24(13)18)4-7-20-17/h4,7,9-10,12,14,20H,2-3,5,8,11H2,1H3/t12-,14+/m0/s1 |
| InChIKey | OTEPCHVFHGNDCV-GXTWGEPZSA-N |
| XLogP | 2.47 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |