C22H26N4O3 — CID 129131877
[2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-1,3-oxazol-4-yl]-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanone (PubChem CID 129131877) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is [2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-1,3-oxazol-4-yl]-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanone.
| Compound Name | [2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-1,3-oxazol-4-yl]-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 129131877 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-1,3-oxazol-4-yl]-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanone |
| SMILES | C/C=C\C=C/C(=C\C)c1nc(C(=O)N2CCNCC2COc2cccnc2)co1 |
| InChI | InChI=1S/C22H26N4O3/c1-3-5-6-8-17(4-2)21-25-20(16-29-21)22(27)26-12-11-24-13-18(26)15-28-19-9-7-10-23-14-19/h3-10,14,16,18,24H,11-13,15H2,1-2H3/b5-3-,8-6-,17-4+ |
| InChIKey | UCXFAEMXKSOWEZ-VYNYJZCISA-N |
| XLogP | 3.10 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|