C30H31ClN6O3S — CID 129132994
(1R,3R,4R,6S)-4-[1-(5-chloro-2-pyridinyl)-4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazol-3-yl]-N-(1-cyanocyclopropyl)bicyclo[4.1.0]heptane-3-carboxamide (PubChem CID 129132994) has the molecular formula C30H31ClN6O3S and a molecular weight of 591.14 g/mol. Its IUPAC name is (1R,3R,4R,6S)-4-[1-(5-chloro-2-pyridinyl)-4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazol-3-yl]-N-(1-cyanocyclopropyl)bicyclo[4.1.0]heptane-3-carboxamide.
| Compound Name | (1R,3R,4R,6S)-4-[1-(5-chloro-2-pyridinyl)-4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazol-3-yl]-N-(1-cyanocyclopropyl)bicyclo[4.1.0]heptane-3-carboxamide |
|---|---|
| PubChem CID | 129132994 |
| Molecular Formula | C30H31ClN6O3S |
| Molecular Weight | 591.14 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | (1R,3R,4R,6S)-4-[1-(5-chloro-2-pyridinyl)-4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazol-3-yl]-N-(1-cyanocyclopropyl)bicyclo[4.1.0]heptane-3-carboxamide |
| SMILES | N#CC1(NC(=O)[C@@H]2C[C@H]3C[C@H]3C[C@H]2c2nn(-c3ccc(Cl)cn3)cc2-c2ccc(N3CCS(=O)(=O)CC3)cc2)CC1 |
| InChI | InChI=1S/C30H31ClN6O3S/c31-22-3-6-27(33-16-22)37-17-26(19-1-4-23(5-2-19)36-9-11-41(39,40)12-10-36)28(35-37)24-14-20-13-21(20)15-25(24)29(38)34-30(18-32)7-8-30/h1-6,16-17,20-21,24-25H,7-15H2,(H,34,38)/t20-,21+,24+,25+/m0/s1 |
| InChIKey | SBCVQXBUXOKWKN-ZNDGRNAPSA-N |
| XLogP | 4.12 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.14 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |