C9H13NO — CID 12913463
5-buta-1,3-dien-2-yl-1-methylpyrrolidin-2-one (PubChem CID 12913463) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yl-1-methylpyrrolidin-2-one.
| Compound Name | 5-buta-1,3-dien-2-yl-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 12913463 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 5-buta-1,3-dien-2-yl-1-methylpyrrolidin-2-one |
| SMILES | C=CC(=C)C1CCC(=O)N1C |
| InChI | InChI=1S/C9H13NO/c1-4-7(2)8-5-6-9(11)10(8)3/h4,8H,1-2,5-6H2,3H3 |
| InChIKey | NTMMKBNBMJOFIK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|