C24H28Cl2N2O — CID 129134913
3,4-dichloro-N-[8-(2-phenylethyl)-8-azaspiro[4.5]decan-4-yl]benzamide (PubChem CID 129134913) has the molecular formula C24H28Cl2N2O and a molecular weight of 431.41 g/mol. Its IUPAC name is 3,4-dichloro-N-[8-(2-phenylethyl)-8-azaspiro[4.5]decan-4-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[8-(2-phenylethyl)-8-azaspiro[4.5]decan-4-yl]benzamide |
|---|---|
| PubChem CID | 129134913 |
| Molecular Formula | C24H28Cl2N2O |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3,4-dichloro-N-[8-(2-phenylethyl)-8-azaspiro[4.5]decan-4-yl]benzamide |
| SMILES | O=C(NC1CCCC12CCN(CCc1ccccc1)CC2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H28Cl2N2O/c25-20-9-8-19(17-21(20)26)23(29)27-22-7-4-11-24(22)12-15-28(16-13-24)14-10-18-5-2-1-3-6-18/h1-3,5-6,8-9,17,22H,4,7,10-16H2,(H,27,29) |
| InChIKey | UVTMFENTZKRZAB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |