C23H28Cl2N2O — CID 13052047
N-[[4-benzyl-1-(dimethylamino)cyclohexyl]methyl]-3,4-dichlorobenzamide (PubChem CID 13052047) has the molecular formula C23H28Cl2N2O and a molecular weight of 419.40 g/mol. Its IUPAC name is N-[[4-benzyl-1-(dimethylamino)cyclohexyl]methyl]-3,4-dichlorobenzamide.
| Compound Name | N-[[4-benzyl-1-(dimethylamino)cyclohexyl]methyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 13052047 |
| Molecular Formula | C23H28Cl2N2O |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[[4-benzyl-1-(dimethylamino)cyclohexyl]methyl]-3,4-dichlorobenzamide |
| SMILES | CN(C)C1(CNC(=O)c2ccc(Cl)c(Cl)c2)CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28Cl2N2O/c1-27(2)23(16-26-22(28)19-8-9-20(24)21(25)15-19)12-10-18(11-13-23)14-17-6-4-3-5-7-17/h3-9,15,18H,10-14,16H2,1-2H3,(H,26,28) |
| InChIKey | WDQTXSJDYFTDDS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |