About 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol
2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol (PubChem CID 129135019) has the molecular formula C10H21O3P
and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol.
Molecular Properties
| Compound Name | 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol |
| PubChem CID | 129135019 |
| Molecular Formula | C10H21O3P |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol |
| SMILES | CC[C@@H]1CC(C)CP(=O)(OCCO)C1 |
| InChI | InChI=1S/C10H21O3P/c1-3-10-6-9(2)7-14(12,8-10)13-5-4-11/h9-11H,3-8H2,1-2H3/t9?,10-,14?/m1/s1 |
| InChIKey | YBWATBFAKXDBEK-OPASDULOSA-N |
| XLogP | 2.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol?
The IUPAC name of 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol (CID 129135019) is 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol.
What is the SMILES notation for 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol?
The canonical SMILES for 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol is CC[C@@H]1CC(C)CP(=O)(OCCO)C1.
What is the InChIKey of 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol?
The InChIKey is YBWATBFAKXDBEK-OPASDULOSA-N. The full InChI is InChI=1S/C10H21O3P/c1-3-10-6-9(2)7-14(12,8-10)13-5-4-11/h9-11H,3-8H2,1-2H3/t9?,10-,14?/m1/s1.
What are the key properties of 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol?
2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol has a molecular weight of 220.25 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R)-3-ethyl-5-methyl-1-oxo-1λ5-phosphinan-1-yl]oxy]ethanol is sourced from PubChem (CID 129135019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).