C4H4ClFN2 — CID 129136206
2-chloro-5-fluoro-1,4-dihydropyrimidine (PubChem CID 129136206) has the molecular formula C4H4ClFN2 and a molecular weight of 134.54 g/mol. Its IUPAC name is 2-chloro-5-fluoro-1,4-dihydropyrimidine.
| Compound Name | 2-chloro-5-fluoro-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 129136206 |
| Molecular Formula | C4H4ClFN2 |
| Molecular Weight | 134.54 g/mol |
| Exact Mass | 134.00 |
| IUPAC Name | 2-chloro-5-fluoro-1,4-dihydropyrimidine |
| SMILES | FC1=CNC(Cl)=NC1 |
| InChI | InChI=1S/C4H4ClFN2/c5-4-7-1-3(6)2-8-4/h1H,2H2,(H,7,8) |
| InChIKey | BIHVKWOBOVJKIC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|