C5H7FN2 — CID 147028247
2-fluoro-5-methyl-1,4-dihydropyrimidine (PubChem CID 147028247) has the molecular formula C5H7FN2 and a molecular weight of 114.12 g/mol. Its IUPAC name is 2-fluoro-5-methyl-1,4-dihydropyrimidine.
| Compound Name | 2-fluoro-5-methyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 147028247 |
| Molecular Formula | C5H7FN2 |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | 2-fluoro-5-methyl-1,4-dihydropyrimidine |
| SMILES | CC1=CNC(F)=NC1 |
| InChI | InChI=1S/C5H7FN2/c1-4-2-7-5(6)8-3-4/h2H,3H2,1H3,(H,7,8) |
| InChIKey | AXBQBHWTFLABFR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|