C20H22FN5S2 — CID 129136298
N-[4-[4-fluoro-2-[(3R)-3-(methylamino)pyrrolidin-1-yl]anilino]phenyl]sulfanyl-1,3-thiazol-4-amine (PubChem CID 129136298) has the molecular formula C20H22FN5S2 and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[4-[4-fluoro-2-[(3R)-3-(methylamino)pyrrolidin-1-yl]anilino]phenyl]sulfanyl-1,3-thiazol-4-amine.
| Compound Name | N-[4-[4-fluoro-2-[(3R)-3-(methylamino)pyrrolidin-1-yl]anilino]phenyl]sulfanyl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 129136298 |
| Molecular Formula | C20H22FN5S2 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[4-[4-fluoro-2-[(3R)-3-(methylamino)pyrrolidin-1-yl]anilino]phenyl]sulfanyl-1,3-thiazol-4-amine |
| SMILES | CN[C@@H]1CCN(c2cc(F)ccc2Nc2ccc(SNc3cscn3)cc2)C1 |
| InChI | InChI=1S/C20H22FN5S2/c1-22-16-8-9-26(11-16)19-10-14(21)2-7-18(19)24-15-3-5-17(6-4-15)28-25-20-12-27-13-23-20/h2-7,10,12-13,16,22,24-25H,8-9,11H2,1H3/t16-/m1/s1 |
| InChIKey | LCRVJEBQXPDDPT-MRXNPFEDSA-N |
| XLogP | 4.94 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|