C21H22ClN5OS2 — CID 155016649
1-[3-[2-[2-chloro-4-(1,3-thiazol-4-ylamino)sulfanylanilino]-5-methylphenyl]imidazolidin-1-yl]ethanone (PubChem CID 155016649) has the molecular formula C21H22ClN5OS2 and a molecular weight of 460.03 g/mol. Its IUPAC name is 1-[3-[2-[2-chloro-4-(1,3-thiazol-4-ylamino)sulfanylanilino]-5-methylphenyl]imidazolidin-1-yl]ethanone.
| Compound Name | 1-[3-[2-[2-chloro-4-(1,3-thiazol-4-ylamino)sulfanylanilino]-5-methylphenyl]imidazolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 155016649 |
| Molecular Formula | C21H22ClN5OS2 |
| Molecular Weight | 460.03 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 1-[3-[2-[2-chloro-4-(1,3-thiazol-4-ylamino)sulfanylanilino]-5-methylphenyl]imidazolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cc(C)ccc2Nc2ccc(SNc3cscn3)cc2Cl)C1 |
| InChI | InChI=1S/C21H22ClN5OS2/c1-14-3-5-19(20(9-14)27-8-7-26(13-27)15(2)28)24-18-6-4-16(10-17(18)22)30-25-21-11-29-12-23-21/h3-6,9-12,24-25H,7-8,13H2,1-2H3 |
| InChIKey | UDPGIRQZZMZBHR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.03 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|