C10H9Br2NO2 — CID 129137304
1-(1,1-dibromobut-1-en-2-yl)-4-nitrobenzene (PubChem CID 129137304) has the molecular formula C10H9Br2NO2 and a molecular weight of 335.00 g/mol. Its IUPAC name is 1-(1,1-dibromobut-1-en-2-yl)-4-nitrobenzene.
| Compound Name | 1-(1,1-dibromobut-1-en-2-yl)-4-nitrobenzene |
|---|---|
| PubChem CID | 129137304 |
| Molecular Formula | C10H9Br2NO2 |
| Molecular Weight | 335.00 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 1-(1,1-dibromobut-1-en-2-yl)-4-nitrobenzene |
| SMILES | CCC(=C(Br)Br)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H9Br2NO2/c1-2-9(10(11)12)7-3-5-8(6-4-7)13(14)15/h3-6H,2H2,1H3 |
| InChIKey | RRFIIXXLOCDMNT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.00 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|