C25H30F2N4O4 — CID 129138154
(3S,7S)-N-[(2,4-difluorophenyl)methyl]-11-hydroxy-7-methyl-N-(3-methylbutyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 129138154) has the molecular formula C25H30F2N4O4 and a molecular weight of 488.54 g/mol. Its IUPAC name is (3S,7S)-N-[(2,4-difluorophenyl)methyl]-11-hydroxy-7-methyl-N-(3-methylbutyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | (3S,7S)-N-[(2,4-difluorophenyl)methyl]-11-hydroxy-7-methyl-N-(3-methylbutyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 129138154 |
| Molecular Formula | C25H30F2N4O4 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (3S,7S)-N-[(2,4-difluorophenyl)methyl]-11-hydroxy-7-methyl-N-(3-methylbutyl)-9,12-dioxo-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CC(C)CCN(Cc1ccc(F)cc1F)C(=O)c1cn2c(c(O)c1=O)C(=O)N1[C@@H](C)CCN[C@@H]1C2 |
| InChI | InChI=1S/C25H30F2N4O4/c1-14(2)7-9-29(11-16-4-5-17(26)10-19(16)27)24(34)18-12-30-13-20-28-8-6-15(3)31(20)25(35)21(30)23(33)22(18)32/h4-5,10,12,14-15,20,28,33H,6-9,11,13H2,1-3H3/t15-,20-/m0/s1 |
| InChIKey | FPSUJCCEELTOMW-YWZLYKJASA-N |
| XLogP | 2.68 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |