C33H36F2N4O5 — CID 130237696
(2S,7S,10S)-N-[(2,4-difluorophenyl)methyl]-N-(2-methoxyethyl)-15,18-dioxo-16-phenylmethoxy-1,9,12-triazatetracyclo[8.8.0.02,7.012,17]octadeca-13,16-diene-14-carboxamide (PubChem CID 130237696) has the molecular formula C33H36F2N4O5 and a molecular weight of 606.67 g/mol. Its IUPAC name is (2S,7S,10S)-N-[(2,4-difluorophenyl)methyl]-N-(2-methoxyethyl)-15,18-dioxo-16-phenylmethoxy-1,9,12-triazatetracyclo[8.8.0.02,7.012,17]octadeca-13,16-diene-14-carboxamide.
| Compound Name | (2S,7S,10S)-N-[(2,4-difluorophenyl)methyl]-N-(2-methoxyethyl)-15,18-dioxo-16-phenylmethoxy-1,9,12-triazatetracyclo[8.8.0.02,7.012,17]octadeca-13,16-diene-14-carboxamide |
|---|---|
| PubChem CID | 130237696 |
| Molecular Formula | C33H36F2N4O5 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | (2S,7S,10S)-N-[(2,4-difluorophenyl)methyl]-N-(2-methoxyethyl)-15,18-dioxo-16-phenylmethoxy-1,9,12-triazatetracyclo[8.8.0.02,7.012,17]octadeca-13,16-diene-14-carboxamide |
| SMILES | COCCN(Cc1ccc(F)cc1F)C(=O)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1[C@@H](C2)NC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C33H36F2N4O5/c1-43-14-13-37(17-23-11-12-24(34)15-26(23)35)32(41)25-18-38-19-28-36-16-22-9-5-6-10-27(22)39(28)33(42)29(38)31(30(25)40)44-20-21-7-3-2-4-8-21/h2-4,7-8,11-12,15,18,22,27-28,36H,5-6,9-10,13-14,16-17,19-20H2,1H3/t22-,27-,28-/m0/s1 |
| InChIKey | PGGPZKBBZDQQHS-FAQZDJIUSA-N |
| XLogP | 3.94 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |