C31H32F2N4O4 — CID 140802638
(3S,7S)-4-cyclobutyl-5-[(2,4-difluorophenyl)methyl]-7-methyl-9,12-dioxo-11-phenylmethoxy-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (PubChem CID 140802638) has the molecular formula C31H32F2N4O4 and a molecular weight of 562.62 g/mol. Its IUPAC name is (3S,7S)-4-cyclobutyl-5-[(2,4-difluorophenyl)methyl]-7-methyl-9,12-dioxo-11-phenylmethoxy-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | (3S,7S)-4-cyclobutyl-5-[(2,4-difluorophenyl)methyl]-7-methyl-9,12-dioxo-11-phenylmethoxy-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 140802638 |
| Molecular Formula | C31H32F2N4O4 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | (3S,7S)-4-cyclobutyl-5-[(2,4-difluorophenyl)methyl]-7-methyl-9,12-dioxo-11-phenylmethoxy-1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| SMILES | C[C@H]1CC(Cc2ccc(F)cc2F)N(C2CCC2)[C@@H]2Cn3cc(C(N)=O)c(=O)c(OCc4ccccc4)c3C(=O)N12 |
| InChI | InChI=1S/C31H32F2N4O4/c1-18-12-23(13-20-10-11-21(32)14-25(20)33)37(22-8-5-9-22)26-16-35-15-24(30(34)39)28(38)29(27(35)31(40)36(18)26)41-17-19-6-3-2-4-7-19/h2-4,6-7,10-11,14-15,18,22-23,26H,5,8-9,12-13,16-17H2,1H3,(H2,34,39)/t18-,23?,26+/m0/s1 |
| InChIKey | XDBPPZGUOQUMTR-BTCHQWDBSA-N |
| XLogP | 3.84 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |