About methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate
methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate (PubChem CID 129138281) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate.
Analyze methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate?
The IUPAC name of methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate (CID 129138281) is methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate.
What is the SMILES notation for methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate?
The canonical SMILES for methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate is COC(=O)C(C)(C(C)C)C(C)(C)C(C)(C)C#N.
What is the InChIKey of methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate?
The InChIKey is AKDVQRCMYQRTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c1-10(2)14(7,11(16)17-8)13(5,6)12(3,4)9-15/h10H,1-8H3.
What are the key properties of methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate?
methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate has a molecular weight of 239.36 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate is sourced from PubChem (CID 129138281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).