methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate

C14H25NO2 — CID 129138281

IUPACmethyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate
SMILESCOC(=O)C(C)(C(C)C)C(C)(C)C(C)(C)C#N
InChIInChI=1S/C14H25NO2/c1-10(2)14(7,11(16)17-8)13(5,6)12(3,4)9-15/h10H,1-8H3
InChIKeyAKDVQRCMYQRTPC-UHFFFAOYSA-N
MW239.36 g/mol
LogP3.40
Rot. Bonds4

About methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate

methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate (PubChem CID 129138281) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate.

Molecular Properties

Compound Namemethyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate
PubChem CID129138281
Molecular FormulaC14H25NO2
Molecular Weight239.36 g/mol
Exact Mass239.19
IUPAC Namemethyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate
SMILESCOC(=O)C(C)(C(C)C)C(C)(C)C(C)(C)C#N
InChIInChI=1S/C14H25NO2/c1-10(2)14(7,11(16)17-8)13(5,6)12(3,4)9-15/h10H,1-8H3
InChIKeyAKDVQRCMYQRTPC-UHFFFAOYSA-N
XLogP3.40
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.36
LogP ≤ 53.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate?
The IUPAC name of methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate (CID 129138281) is methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate.
What is the SMILES notation for methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate?
The canonical SMILES for methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate is COC(=O)C(C)(C(C)C)C(C)(C)C(C)(C)C#N.
What is the InChIKey of methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate?
The InChIKey is AKDVQRCMYQRTPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c1-10(2)14(7,11(16)17-8)13(5,6)12(3,4)9-15/h10H,1-8H3.
What are the key properties of methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate?
methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate has a molecular weight of 239.36 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-cyano-2,3,3,4-tetramethyl-2-propan-2-ylpentanoate is sourced from PubChem (CID 129138281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).