C24H19ClN2O3 — CID 129138535
4-[(2R,3R,5S,6R)-10-chloro-2-hydroxy-3-(hydroxymethyl)-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile (PubChem CID 129138535) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is 4-[(2R,3R,5S,6R)-10-chloro-2-hydroxy-3-(hydroxymethyl)-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2R,3R,5S,6R)-10-chloro-2-hydroxy-3-(hydroxymethyl)-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129138535 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-[(2R,3R,5S,6R)-10-chloro-2-hydroxy-3-(hydroxymethyl)-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@]23Oc4cc(Cl)cnc4[C@]2(O)[C@@H](CO)C[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19ClN2O3/c25-19-11-21-22(27-13-19)23(29)18(14-28)10-20(16-4-2-1-3-5-16)24(23,30-21)17-8-6-15(12-26)7-9-17/h1-9,11,13,18,20,28-29H,10,14H2/t18-,20+,23-,24+/m1/s1 |
| InChIKey | GCXMOFRWPJNHKN-ZOGBDMNLSA-N |
| XLogP | 3.88 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |