C26H25ClN2O5 — CID 129138661
(2S,3R,4R,5S,6R)-10-chloro-2,3-dihydroxy-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide (PubChem CID 129138661) has the molecular formula C26H25ClN2O5 and a molecular weight of 480.95 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-10-chloro-2,3-dihydroxy-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-10-chloro-2,3-dihydroxy-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 129138661 |
| Molecular Formula | C26H25ClN2O5 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-10-chloro-2,3-dihydroxy-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
| SMILES | COc1ccc([C@@]23Oc4cc(Cl)cnc4[C@]2(O)[C@H](O)[C@H](C(=O)N(C)C)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25ClN2O5/c1-29(2)24(31)20-21(15-7-5-4-6-8-15)26(16-9-11-18(33-3)12-10-16)25(32,23(20)30)22-19(34-26)13-17(27)14-28-22/h4-14,20-21,23,30,32H,1-3H3/t20-,21-,23-,25+,26+/m1/s1 |
| InChIKey | NWUFKLOUKLIARG-VRFYTPIESA-N |
| XLogP | 3.08 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |