C26H25BrN2O5 — CID 129138739
(2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide (PubChem CID 129138739) has the molecular formula C26H25BrN2O5 and a molecular weight of 525.40 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 129138739 |
| Molecular Formula | C26H25BrN2O5 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-N,N-dimethyl-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
| SMILES | COc1nccc2c1[C@]1(O)[C@H](O)[C@H](C(=O)N(C)C)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C26H25BrN2O5/c1-29(2)24(31)19-20(15-7-5-4-6-8-15)26(16-9-11-17(27)12-10-16)25(32,22(19)30)21-18(34-26)13-14-28-23(21)33-3/h4-14,19-20,22,30,32H,1-3H3/t19-,20-,22-,25+,26+/m1/s1 |
| InChIKey | HVUATNYKYYYUJY-YHVMUTAASA-N |
| XLogP | 3.19 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |