C27H25N3O5 — CID 140787866
(2S,3R,4R,5S,6R)-2,3-dihydroxy-10-isocyano-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide (PubChem CID 140787866) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2,3-dihydroxy-10-isocyano-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-2,3-dihydroxy-10-isocyano-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 140787866 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2,3-dihydroxy-10-isocyano-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
| SMILES | [C-]#[N+]c1cnc2c(c1)O[C@@]1(c3ccc(OC)cc3)[C@H](c3ccccc3)[C@@H](C(=O)N(C)C)[C@@H](O)[C@@]21O |
| InChI | InChI=1S/C27H25N3O5/c1-28-18-14-20-23(29-15-18)26(33)24(31)21(25(32)30(2)3)22(16-8-6-5-7-9-16)27(26,35-20)17-10-12-19(34-4)13-11-17/h5-15,21-22,24,31,33H,2-4H3/t21-,22-,24-,26+,27+/m1/s1 |
| InChIKey | XDHWTOXBIGYPSW-PXIJUOARSA-N |
| XLogP | 2.98 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|