C26H24ClN3O4S — CID 140928593
(2R,3S,4S,5S,6R)-10-chloro-2-hydroxy-6-(4-isocyanophenyl)-N,N,3-trimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide (PubChem CID 140928593) has the molecular formula C26H24ClN3O4S and a molecular weight of 510.02 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-10-chloro-2-hydroxy-6-(4-isocyanophenyl)-N,N,3-trimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide.
| Compound Name | (2R,3S,4S,5S,6R)-10-chloro-2-hydroxy-6-(4-isocyanophenyl)-N,N,3-trimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide |
|---|---|
| PubChem CID | 140928593 |
| Molecular Formula | C26H24ClN3O4S |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | (2R,3S,4S,5S,6R)-10-chloro-2-hydroxy-6-(4-isocyanophenyl)-N,N,3-trimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-sulfonamide |
| SMILES | [C-]#[N+]c1ccc([C@@]23Oc4cc(Cl)cnc4[C@]2(O)[C@H](C)[C@H](S(=O)(=O)N(C)C)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24ClN3O4S/c1-16-23(35(32,33)30(3)4)22(17-8-6-5-7-9-17)26(18-10-12-20(28-2)13-11-18)25(16,31)24-21(34-26)14-19(27)15-29-24/h5-16,22-23,31H,1,3-4H3/t16-,22-,23+,25-,26+/m1/s1 |
| InChIKey | MXAQAYCPYDIJHJ-RWGZJCOPSA-N |
| XLogP | 4.45 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|