C23H19BrClNO5S — CID 146546634
[(2S,3S,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-4-yl]methanesulfinic acid (PubChem CID 146546634) has the molecular formula C23H19BrClNO5S and a molecular weight of 536.83 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-4-yl]methanesulfinic acid.
| Compound Name | [(2S,3S,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-4-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 146546634 |
| Molecular Formula | C23H19BrClNO5S |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 534.99 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-6-(4-bromophenyl)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-4-yl]methanesulfinic acid |
| SMILES | O=S(O)C[C@@H]1[C@@H](c2ccccc2)[C@]2(c3ccc(Br)cc3)Oc3cc(Cl)cnc3[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C23H19BrClNO5S/c24-15-8-6-14(7-9-15)23-19(13-4-2-1-3-5-13)17(12-32(29)30)21(27)22(23,28)20-18(31-23)10-16(25)11-26-20/h1-11,17,19,21,27-28H,12H2,(H,29,30)/t17-,19-,21+,22+,23+/m1/s1 |
| InChIKey | MPARGJPDSVBCOQ-NGOCLCQQSA-N |
| XLogP | 3.97 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|