C23H17ClN2O3 — CID 129139164
4-[(2S,3R,5S,6R)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile (PubChem CID 129139164) has the molecular formula C23H17ClN2O3 and a molecular weight of 404.85 g/mol. Its IUPAC name is 4-[(2S,3R,5S,6R)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R,5S,6R)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 129139164 |
| Molecular Formula | C23H17ClN2O3 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 4-[(2S,3R,5S,6R)-10-chloro-2,3-dihydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-6-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@]23Oc4cc(Cl)cnc4[C@]2(O)[C@H](O)C[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17ClN2O3/c24-17-10-19-21(26-13-17)22(28)20(27)11-18(15-4-2-1-3-5-15)23(22,29-19)16-8-6-14(12-25)7-9-16/h1-10,13,18,20,27-28H,11H2/t18-,20+,22+,23-/m0/s1 |
| InChIKey | WROYRSLZTJVSEE-WJFJTQNHSA-N |
| XLogP | 3.63 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |