C27H27ClN2O4 — CID 129180257
(2R,4S,5S,6R)-10-chloro-2-methoxy-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide (PubChem CID 129180257) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is (2R,4S,5S,6R)-10-chloro-2-methoxy-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide.
| Compound Name | (2R,4S,5S,6R)-10-chloro-2-methoxy-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
|---|---|
| PubChem CID | 129180257 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (2R,4S,5S,6R)-10-chloro-2-methoxy-6-(4-methoxyphenyl)-N,N-dimethyl-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxamide |
| SMILES | COc1ccc([C@@]23Oc4cc(Cl)cnc4[C@]2(OC)C[C@H](C(=O)N(C)C)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27ClN2O4/c1-30(2)25(31)21-15-26(33-4)24-22(14-19(28)16-29-24)34-27(26,18-10-12-20(32-3)13-11-18)23(21)17-8-6-5-7-9-17/h5-14,16,21,23H,15H2,1-4H3/t21-,23+,26+,27-/m0/s1 |
| InChIKey | ZAPWUKBZTLYWTO-MMETVNMOSA-N |
| XLogP | 4.77 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |